C20H31N3O6 — CID 59656975
[3,5-dimethyl-4-[[3-[2-[2-(methylamino)ethoxy]ethylamino]-3-oxopropyl]carbamoyloxy]phenyl]methyl acetate (PubChem CID 59656975) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is [3,5-dimethyl-4-[[3-[2-[2-(methylamino)ethoxy]ethylamino]-3-oxopropyl]carbamoyloxy]phenyl]methyl acetate.
| Compound Name | [3,5-dimethyl-4-[[3-[2-[2-(methylamino)ethoxy]ethylamino]-3-oxopropyl]carbamoyloxy]phenyl]methyl acetate |
|---|---|
| PubChem CID | 59656975 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [3,5-dimethyl-4-[[3-[2-[2-(methylamino)ethoxy]ethylamino]-3-oxopropyl]carbamoyloxy]phenyl]methyl acetate |
| SMILES | CNCCOCCNC(=O)CCNC(=O)Oc1c(C)cc(COC(C)=O)cc1C |
| InChI | InChI=1S/C20H31N3O6/c1-14-11-17(13-28-16(3)24)12-15(2)19(14)29-20(26)23-6-5-18(25)22-8-10-27-9-7-21-4/h11-12,21H,5-10,13H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | IYFHGTYSEBPINF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|