C6H13IN2O3 — CID 167046629
iodo N-[2-[2-(methylamino)ethoxy]ethyl]carbamate (PubChem CID 167046629) has the molecular formula C6H13IN2O3 and a molecular weight of 288.09 g/mol. Its IUPAC name is iodo N-[2-[2-(methylamino)ethoxy]ethyl]carbamate.
| Compound Name | iodo N-[2-[2-(methylamino)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 167046629 |
| Molecular Formula | C6H13IN2O3 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | iodo N-[2-[2-(methylamino)ethoxy]ethyl]carbamate |
| SMILES | CNCCOCCNC(=O)OI |
| InChI | InChI=1S/C6H13IN2O3/c1-8-2-4-11-5-3-9-6(10)12-7/h8H,2-5H2,1H3,(H,9,10) |
| InChIKey | FASOQPXMXQGHKT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|