C14H22N2O3S — CID 142164465
[4-[[1-hydroxy-2-(methylamino)propyl]amino]-3,5-dimethylphenyl]methoxymethanethioic S-acid (PubChem CID 142164465) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is [4-[[1-hydroxy-2-(methylamino)propyl]amino]-3,5-dimethylphenyl]methoxymethanethioic S-acid.
| Compound Name | [4-[[1-hydroxy-2-(methylamino)propyl]amino]-3,5-dimethylphenyl]methoxymethanethioic S-acid |
|---|---|
| PubChem CID | 142164465 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [4-[[1-hydroxy-2-(methylamino)propyl]amino]-3,5-dimethylphenyl]methoxymethanethioic S-acid |
| SMILES | CNC(C)C(O)Nc1c(C)cc(COC(=O)S)cc1C |
| InChI | InChI=1S/C14H22N2O3S/c1-8-5-11(7-19-14(18)20)6-9(2)12(8)16-13(17)10(3)15-4/h5-6,10,13,15-17H,7H2,1-4H3,(H,18,20) |
| InChIKey | JCQYXHYZRGDLDH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|