C52H44F2O13 — CID 87646624
[(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate (PubChem CID 87646624) has the molecular formula C52H44F2O13 and a molecular weight of 914.91 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 87646624 |
| Molecular Formula | C52H44F2O13 |
| Molecular Weight | 914.91 g/mol |
| Exact Mass | 914.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-[5-(acetyloxymethyl)-2-[[4-(difluoromethoxy)phenyl]methyl]phenyl]-4,5-dibenzoyloxy-2-[(1S)-1-benzoyloxyethyl]-6-hydroxyoxan-3-yl] benzoate |
| SMILES | CC(=O)OCc1ccc(Cc2ccc(OC(F)F)cc2)c([C@@]2(O)O[C@H]([C@H](C)OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C52H44F2O13/c1-32(62-47(56)36-15-7-3-8-16-36)43-44(64-48(57)37-17-9-4-10-18-37)45(65-49(58)38-19-11-5-12-20-38)46(66-50(59)39-21-13-6-14-22-39)52(60,67-43)42-30-35(31-61-33(2)55)23-26-40(42)29-34-24-27-41(28-25-34)63-51(53)54/h3-28,30,32,43-46,51,60H,29,31H2,1-2H3/t32-,43+,44+,45-,46+,52+/m0/s1 |
| InChIKey | XGXSJPCNQCNZAW-KGTRWXICSA-N |
| XLogP | 8.41 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.91 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|