C26H34O10 — CID 68987723
[4-[(4-propan-2-yloxyphenyl)methyl]-3-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-[(1S)-1-hydroxyethyl]oxan-2-yl]phenyl]methyl 2-hydroxyacetate (PubChem CID 68987723) has the molecular formula C26H34O10 and a molecular weight of 506.55 g/mol. Its IUPAC name is [4-[(4-propan-2-yloxyphenyl)methyl]-3-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-[(1S)-1-hydroxyethyl]oxan-2-yl]phenyl]methyl 2-hydroxyacetate.
| Compound Name | [4-[(4-propan-2-yloxyphenyl)methyl]-3-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-[(1S)-1-hydroxyethyl]oxan-2-yl]phenyl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 68987723 |
| Molecular Formula | C26H34O10 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | [4-[(4-propan-2-yloxyphenyl)methyl]-3-[(2R,3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-[(1S)-1-hydroxyethyl]oxan-2-yl]phenyl]methyl 2-hydroxyacetate |
| SMILES | CC(C)Oc1ccc(Cc2ccc(COC(=O)CO)cc2[C@@]2(O)O[C@H]([C@H](C)O)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H34O10/c1-14(2)35-19-8-5-16(6-9-19)10-18-7-4-17(13-34-21(29)12-27)11-20(18)26(33)25(32)23(31)22(30)24(36-26)15(3)28/h4-9,11,14-15,22-25,27-28,30-33H,10,12-13H2,1-3H3/t15-,22-,23-,24+,25+,26+/m0/s1 |
| InChIKey | QOLXUZZJDVMZTD-UBWKXACOSA-N |
| XLogP | 0.11 |
| TPSA | 166.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |