C25H36N2O9 — CID 90984986
methyl (3S,4S,5S,6S)-3,4,5-trihydroxy-6-[hydroxy-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxymethyl]oxane-3-carboxylate (PubChem CID 90984986) has the molecular formula C25H36N2O9 and a molecular weight of 508.57 g/mol. Its IUPAC name is methyl (3S,4S,5S,6S)-3,4,5-trihydroxy-6-[hydroxy-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxymethyl]oxane-3-carboxylate.
| Compound Name | methyl (3S,4S,5S,6S)-3,4,5-trihydroxy-6-[hydroxy-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxymethyl]oxane-3-carboxylate |
|---|---|
| PubChem CID | 90984986 |
| Molecular Formula | C25H36N2O9 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | methyl (3S,4S,5S,6S)-3,4,5-trihydroxy-6-[hydroxy-[5-methyl-1-propan-2-yl-4-[(4-propan-2-yloxyphenyl)methyl]pyrazol-3-yl]oxymethyl]oxane-3-carboxylate |
| SMILES | COC(=O)[C@]1(O)CO[C@H](C(O)Oc2nn(C(C)C)c(C)c2Cc2ccc(OC(C)C)cc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H36N2O9/c1-13(2)27-15(5)18(11-16-7-9-17(10-8-16)35-14(3)4)22(26-27)36-23(30)20-19(28)21(29)25(32,12-34-20)24(31)33-6/h7-10,13-14,19-21,23,28-30,32H,11-12H2,1-6H3/t19-,20+,21+,23?,25+/m1/s1 |
| InChIKey | OZGCZVSPRYNXHF-MERDSGSFSA-N |
| XLogP | 0.87 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|