C23H27ClF2O7 — CID 50939021
(2S,3R,4S,5S,6R)-2-[3-chloro-2-[[4-(2,2-difluoroethyl)phenyl]methyl]-5-(hydroxymethyl)phenoxy]-6-(1-hydroxyethyl)oxane-3,4,5-triol (PubChem CID 50939021) has the molecular formula C23H27ClF2O7 and a molecular weight of 488.91 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[3-chloro-2-[[4-(2,2-difluoroethyl)phenyl]methyl]-5-(hydroxymethyl)phenoxy]-6-(1-hydroxyethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[3-chloro-2-[[4-(2,2-difluoroethyl)phenyl]methyl]-5-(hydroxymethyl)phenoxy]-6-(1-hydroxyethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50939021 |
| Molecular Formula | C23H27ClF2O7 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[3-chloro-2-[[4-(2,2-difluoroethyl)phenyl]methyl]-5-(hydroxymethyl)phenoxy]-6-(1-hydroxyethyl)oxane-3,4,5-triol |
| SMILES | CC(O)[C@H]1O[C@@H](Oc2cc(CO)cc(Cl)c2Cc2ccc(CC(F)F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27ClF2O7/c1-11(28)22-20(30)19(29)21(31)23(33-22)32-17-8-14(10-27)7-16(24)15(17)6-12-2-4-13(5-3-12)9-18(25)26/h2-5,7-8,11,18-23,27-31H,6,9-10H2,1H3/t11?,19-,20-,21+,22+,23+/m0/s1 |
| InChIKey | YUKPUNJBPSCZNN-ONUFEXPVSA-N |
| XLogP | 1.80 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |