C25H33NO7 — CID 68984343
(2R,3S,4S,5R,6S)-2-[(1R)-1-hydroxyethyl]-6-[2-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]phenoxy]oxane-3,4,5-triol (PubChem CID 68984343) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[(1R)-1-hydroxyethyl]-6-[2-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[(1R)-1-hydroxyethyl]-6-[2-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 68984343 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[(1R)-1-hydroxyethyl]-6-[2-[[4-(4-hydroxypiperidin-1-yl)phenyl]methyl]phenoxy]oxane-3,4,5-triol |
| SMILES | C[C@@H](O)[C@H]1O[C@@H](Oc2ccccc2Cc2ccc(N3CCC(O)CC3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H33NO7/c1-15(27)24-22(30)21(29)23(31)25(33-24)32-20-5-3-2-4-17(20)14-16-6-8-18(9-7-16)26-12-10-19(28)11-13-26/h2-9,15,19,21-25,27-31H,10-14H2,1H3/t15-,21+,22+,23-,24-,25-/m1/s1 |
| InChIKey | TYFJEOOTYBJDFD-FUERHRBLSA-N |
| XLogP | 0.81 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|