C25H31ClO9 — CID 68986421
[3-chloro-4-[(4-ethoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl acetate (PubChem CID 68986421) has the molecular formula C25H31ClO9 and a molecular weight of 510.97 g/mol. Its IUPAC name is [3-chloro-4-[(4-ethoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl acetate.
| Compound Name | [3-chloro-4-[(4-ethoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 68986421 |
| Molecular Formula | C25H31ClO9 |
| Molecular Weight | 510.97 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [3-chloro-4-[(4-ethoxyphenyl)methyl]-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]oxyphenyl]methyl acetate |
| SMILES | CCOc1ccc(Cc2c(Cl)cc(COC(C)=O)cc2O[C@@H]2O[C@H]([C@@H](C)O)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C25H31ClO9/c1-4-32-17-7-5-15(6-8-17)9-18-19(26)10-16(12-33-14(3)28)11-20(18)34-25-23(31)21(29)22(30)24(35-25)13(2)27/h5-8,10-11,13,21-25,27,29-31H,4,9,12H2,1-3H3/t13-,21+,22+,23-,24-,25-/m1/s1 |
| InChIKey | HGTPXMGERQPONG-JPVDBADHSA-N |
| XLogP | 1.96 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.97 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |