C21H25FO5 — CID 143162301
(2S,3R,4S,5S)-2-[3-[(3-fluoro-4-methoxyphenyl)methyl]-5-methylphenyl]-6-methyloxane-3,4,5-triol (PubChem CID 143162301) has the molecular formula C21H25FO5 and a molecular weight of 376.42 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[3-[(3-fluoro-4-methoxyphenyl)methyl]-5-methylphenyl]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[3-[(3-fluoro-4-methoxyphenyl)methyl]-5-methylphenyl]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 143162301 |
| Molecular Formula | C21H25FO5 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (2S,3R,4S,5S)-2-[3-[(3-fluoro-4-methoxyphenyl)methyl]-5-methylphenyl]-6-methyloxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc(C)cc([C@@H]3OC(C)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1F |
| InChI | InChI=1S/C21H25FO5/c1-11-6-14(8-13-4-5-17(26-3)16(22)10-13)9-15(7-11)21-20(25)19(24)18(23)12(2)27-21/h4-7,9-10,12,18-21,23-25H,8H2,1-3H3/t12?,18-,19+,20-,21+/m1/s1 |
| InChIKey | GBPKBPANJBNXJD-OETYQTQASA-N |
| XLogP | 2.28 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |