C19H26N2O7 — CID 90810067
(3R,4S,5S,6R)-2-[[4-[(4-ethoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 90810067) has the molecular formula C19H26N2O7 and a molecular weight of 394.42 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[[4-[(4-ethoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[[4-[(4-ethoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90810067 |
| Molecular Formula | C19H26N2O7 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3R,4S,5S,6R)-2-[[4-[(4-ethoxyphenyl)methyl]-5-methyl-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2c(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)n[nH]c2C)cc1 |
| InChI | InChI=1S/C19H26N2O7/c1-3-26-12-6-4-11(5-7-12)8-13-10(2)20-21-18(13)28-19-17(25)16(24)15(23)14(9-22)27-19/h4-7,14-17,19,22-25H,3,8-9H2,1-2H3,(H,20,21)/t14-,15-,16+,17-,19?/m1/s1 |
| InChIKey | KRPHSDWUPQNDLM-YPEANGHVSA-N |
| XLogP | -0.11 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |