C24H37N2O7+ — CID 69013042
(2S,3R,4S,5S,6R)-2-[4-[(4-ethoxyphenyl)methyl]-1-ethyl-5-methyl-1-propylpyrazol-1-ium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 69013042) has the molecular formula C24H37N2O7+ and a molecular weight of 465.57 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[4-[(4-ethoxyphenyl)methyl]-1-ethyl-5-methyl-1-propylpyrazol-1-ium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[4-[(4-ethoxyphenyl)methyl]-1-ethyl-5-methyl-1-propylpyrazol-1-ium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 69013042 |
| Molecular Formula | C24H37N2O7+ |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[4-[(4-ethoxyphenyl)methyl]-1-ethyl-5-methyl-1-propylpyrazol-1-ium-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC[N+]1(CC)N=C(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(Cc2ccc(OCC)cc2)=C1C |
| InChI | InChI=1S/C24H37N2O7/c1-5-12-26(6-2)15(4)18(13-16-8-10-17(11-9-16)31-7-3)23(25-26)33-24-22(30)21(29)20(28)19(14-27)32-24/h8-11,19-22,24,27-30H,5-7,12-14H2,1-4H3/q+1/t19-,20-,21+,22-,24+,26?/m1/s1 |
| InChIKey | JHPKDEMBMNFOOQ-HBNCUUSWSA-N |
| XLogP | 1.29 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|