C19H23F3N2O6S — CID 67259617
(2R,3R,4S,5S,6R)-3-[[4-[(4-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 67259617) has the molecular formula C19H23F3N2O6S and a molecular weight of 464.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-3-[[4-[(4-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-3-[[4-[(4-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67259617 |
| Molecular Formula | C19H23F3N2O6S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (2R,3R,4S,5S,6R)-3-[[4-[(4-ethylsulfanylphenyl)methyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]oxy]-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | CCSc1ccc(Cc2c(O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]3O)n[nH]c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H23F3N2O6S/c1-2-31-10-5-3-9(4-6-10)7-11-16(19(20,21)22)23-24-17(11)30-15-14(27)13(26)12(8-25)29-18(15)28/h3-6,12-15,18,25-28H,2,7-8H2,1H3,(H,23,24)/t12-,13-,14+,15-,18-/m1/s1 |
| InChIKey | ZHZFEZYIEYOFTN-VPKNTQAGSA-N |
| XLogP | 1.31 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |