C22H21NO2 — CID 91551070
2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]-6-methylcyclohex-2-en-4-yn-1-one (PubChem CID 91551070) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]-6-methylcyclohex-2-en-4-yn-1-one.
| Compound Name | 2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]-6-methylcyclohex-2-en-4-yn-1-one |
|---|---|
| PubChem CID | 91551070 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[[(2-hydroxy-1,2-diphenylethyl)amino]methyl]-6-methylcyclohex-2-en-4-yn-1-one |
| SMILES | CC1C#CC=C(CNC(c2ccccc2)C(O)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H21NO2/c1-16-9-8-14-19(21(16)24)15-23-20(17-10-4-2-5-11-17)22(25)18-12-6-3-7-13-18/h2-7,10-14,16,20,22-23,25H,15H2,1H3 |
| InChIKey | ZQCWERTYEWQPRX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|