C13H32N2O3Si — CID 91551145
4-triethoxysilylheptane-1,4-diamine (PubChem CID 91551145) has the molecular formula C13H32N2O3Si and a molecular weight of 292.50 g/mol. Its IUPAC name is 4-triethoxysilylheptane-1,4-diamine.
| Compound Name | 4-triethoxysilylheptane-1,4-diamine |
|---|---|
| PubChem CID | 91551145 |
| Molecular Formula | C13H32N2O3Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4-triethoxysilylheptane-1,4-diamine |
| SMILES | CCCC(N)(CCCN)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H32N2O3Si/c1-5-10-13(15,11-9-12-14)19(16-6-2,17-7-3)18-8-4/h5-12,14-15H2,1-4H3 |
| InChIKey | YTJMNXRLRBSXMV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|