C20H17BBrN3O4 — CID 91551318
[5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]oxy-(3,4-dimethoxyphenyl)borinic acid (PubChem CID 91551318) has the molecular formula C20H17BBrN3O4 and a molecular weight of 454.09 g/mol. Its IUPAC name is [5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]oxy-(3,4-dimethoxyphenyl)borinic acid.
| Compound Name | [5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]oxy-(3,4-dimethoxyphenyl)borinic acid |
|---|---|
| PubChem CID | 91551318 |
| Molecular Formula | C20H17BBrN3O4 |
| Molecular Weight | 454.09 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [5-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-pyridinyl]oxy-(3,4-dimethoxyphenyl)borinic acid |
| SMILES | COc1ccc(B(O)Oc2ccc(-c3c[nH]c4ncc(Br)cc34)cn2)cc1OC |
| InChI | InChI=1S/C20H17BBrN3O4/c1-27-17-5-4-13(7-18(17)28-2)21(26)29-19-6-3-12(9-23-19)16-11-25-20-15(16)8-14(22)10-24-20/h3-11,26H,1-2H3,(H,24,25) |
| InChIKey | AHVVJHXDGHMXRF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.09 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|