C21H28N2O4 — CID 91552613
4-[3-methoxy-2,5-dimethyl-4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid (PubChem CID 91552613) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-[3-methoxy-2,5-dimethyl-4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid.
| Compound Name | 4-[3-methoxy-2,5-dimethyl-4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 91552613 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[3-methoxy-2,5-dimethyl-4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
| SMILES | COc1c(C)c(CCCC(=O)O)cc(C)c1OCCCNc1ccccn1 |
| InChI | InChI=1S/C21H28N2O4/c1-15-14-17(8-6-10-19(24)25)16(2)21(26-3)20(15)27-13-7-12-23-18-9-4-5-11-22-18/h4-5,9,11,14H,6-8,10,12-13H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | VSYBZPGRUSPHNH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|