C19H15FN4 — CID 915528
(1S,8aS)-4-amino-1-(3-fluorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile (PubChem CID 915528) has the molecular formula C19H15FN4 and a molecular weight of 318.36 g/mol. Its IUPAC name is (1S,8aS)-4-amino-1-(3-fluorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile.
| Compound Name | (1S,8aS)-4-amino-1-(3-fluorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 915528 |
| Molecular Formula | C19H15FN4 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | (1S,8aS)-4-amino-1-(3-fluorophenyl)-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C2=CCCC[C@H]2[C@@H](c2cccc(F)c2)C1(C#N)C#N |
| InChI | InChI=1S/C19H15FN4/c20-13-5-3-4-12(8-13)17-14-6-1-2-7-15(14)18(24)16(9-21)19(17,10-22)11-23/h3-5,7-8,14,17H,1-2,6,24H2/t14-,17-/m1/s1 |
| InChIKey | IWSDVPIJHURQEI-RHSMWYFYSA-N |
| XLogP | 3.42 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |