C23H20N4O5 — CID 91553722
5-[(5-methyl-3-oxo-1H-isoindol-2-yl)methyl]-5-(6-propanoylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione (PubChem CID 91553722) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is 5-[(5-methyl-3-oxo-1H-isoindol-2-yl)methyl]-5-(6-propanoylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methyl-3-oxo-1H-isoindol-2-yl)methyl]-5-(6-propanoylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91553722 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-[(5-methyl-3-oxo-1H-isoindol-2-yl)methyl]-5-(6-propanoylfuro[3,2-b]pyridin-2-yl)imidazolidine-2,4-dione |
| SMILES | CCC(=O)c1cnc2cc(C3(CN4Cc5ccc(C)cc5C4=O)NC(=O)NC3=O)oc2c1 |
| InChI | InChI=1S/C23H20N4O5/c1-3-17(28)14-7-18-16(24-9-14)8-19(32-18)23(21(30)25-22(31)26-23)11-27-10-13-5-4-12(2)6-15(13)20(27)29/h4-9H,3,10-11H2,1-2H3,(H2,25,26,30,31) |
| InChIKey | GJLSAKFDRADMLI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|