C46H92O22 — CID 91553735
2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)-14-methylpentadecanoic acid (PubChem CID 91553735) has the molecular formula C46H92O22 and a molecular weight of 997.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)-14-methylpentadecanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)-14-methylpentadecanoic acid |
|---|---|
| PubChem CID | 91553735 |
| Molecular Formula | C46H92O22 |
| Molecular Weight | 997.22 g/mol |
| Exact Mass | 996.61 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)-14-methylpentadecanoic acid |
| SMILES | CC(C)CCCCCCCC(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C46H92O22/c1-30(2)8-6-4-3-5-7-9-42(10-31(57)20-47,11-32(58)21-48)44(14-35(61)24-51,15-36(62)25-52)46(18-39(65)28-55,19-40(66)29-56)45(16-37(63)26-53,17-38(64)27-54)43(41(67)68,12-33(59)22-49)13-34(60)23-50/h30-40,47-66H,3-29H2,1-2H3,(H,67,68) |
| InChIKey | GEPXIBMEZWCYRR-UHFFFAOYSA-N |
| XLogP | -4.18 |
| TPSA | 441.90 Ų |
| H-Bond Donors | 21 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.22 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 21 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|