C48H94O22 — CID 54457296
2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)octadec-9-enoic acid (PubChem CID 54457296) has the molecular formula C48H94O22 and a molecular weight of 1023.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)octadec-9-enoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)octadec-9-enoic acid |
|---|---|
| PubChem CID | 54457296 |
| Molecular Formula | C48H94O22 |
| Molecular Weight | 1023.26 g/mol |
| Exact Mass | 1022.62 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decakis(2,3-dihydroxypropyl)octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCC(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(CC(O)CO)(CC(O)CO)C(=O)O |
| InChI | InChI=1S/C48H94O22/c1-2-3-4-5-6-7-8-9-10-11-12-44(13-33(59)23-49,14-34(60)24-50)46(17-37(63)27-53,18-38(64)28-54)48(21-41(67)31-57,22-42(68)32-58)47(19-39(65)29-55,20-40(66)30-56)45(43(69)70,15-35(61)25-51)16-36(62)26-52/h9-10,33-42,49-68H,2-8,11-32H2,1H3,(H,69,70) |
| InChIKey | WZCJXRBPDMQCOI-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 441.90 Ų |
| H-Bond Donors | 21 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.26 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 21 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|