C19H17FIN3O5 — CID 91554902
N-(2-fluoro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]acetamide (PubChem CID 91554902) has the molecular formula C19H17FIN3O5 and a molecular weight of 513.26 g/mol. Its IUPAC name is N-(2-fluoro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]acetamide.
| Compound Name | N-(2-fluoro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]acetamide |
|---|---|
| PubChem CID | 91554902 |
| Molecular Formula | C19H17FIN3O5 |
| Molecular Weight | 513.26 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | N-(2-fluoro-4-iodophenyl)-2-[4-hydroxy-5-[4-(2-hydroxyethoxy)phenyl]-2-oxo-1H-imidazol-3-yl]acetamide |
| SMILES | O=C(Cn1c(O)c(-c2ccc(OCCO)cc2)[nH]c1=O)Nc1ccc(I)cc1F |
| InChI | InChI=1S/C19H17FIN3O5/c20-14-9-12(21)3-6-15(14)22-16(26)10-24-18(27)17(23-19(24)28)11-1-4-13(5-2-11)29-8-7-25/h1-6,9,25,27H,7-8,10H2,(H,22,26)(H,23,28) |
| InChIKey | MPEDJRFLLGLJQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|