About 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate
2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate (PubChem CID 91555651) has the molecular formula C23H38O3
and a molecular weight of 362.55 g/mol. Its IUPAC name is 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate.
Molecular Properties
| Compound Name | 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate |
| PubChem CID | 91555651 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate |
| SMILES | CCCCCCCCCc1ccc(OC(C)COC(=O)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C23H38O3/c1-5-7-8-9-10-11-12-13-21-14-16-22(17-15-21)26-20(4)18-25-23(24)19(3)6-2/h14-17,19-20H,5-13,18H2,1-4H3/t19-,20?/m0/s1 |
| InChIKey | BAJWSCLCTCMYOR-XJDOXCRVSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate?
The IUPAC name of 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate (CID 91555651) is 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate.
What is the SMILES notation for 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate?
The canonical SMILES for 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate is CCCCCCCCCc1ccc(OC(C)COC(=O)[C@@H](C)CC)cc1.
What is the InChIKey of 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate?
The InChIKey is BAJWSCLCTCMYOR-XJDOXCRVSA-N. The full InChI is InChI=1S/C23H38O3/c1-5-7-8-9-10-11-12-13-21-14-16-22(17-15-21)26-20(4)18-25-23(24)19(3)6-2/h14-17,19-20H,5-13,18H2,1-4H3/t19-,20?/m0/s1.
What are the key properties of 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate?
2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate has a molecular weight of 362.55 g/mol, XLogP of 6.34, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nonylphenoxy)propyl (2S)-2-methylbutanoate is sourced from PubChem (CID 91555651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).