C20H16F2N2O3S — CID 9155660
2-fluoro-N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]benzamide (PubChem CID 9155660) has the molecular formula C20H16F2N2O3S and a molecular weight of 402.42 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]benzamide.
| Compound Name | 2-fluoro-N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]benzamide |
|---|---|
| PubChem CID | 9155660 |
| Molecular Formula | C20H16F2N2O3S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-fluoro-N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]benzamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)S(=O)(=O)c1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H16F2N2O3S/c21-15-7-9-16(10-8-15)28(26,27)19(14-4-3-11-23-12-14)13-24-20(25)17-5-1-2-6-18(17)22/h1-12,19H,13H2,(H,24,25)/t19-/m0/s1 |
| InChIKey | OITZSGRGBFNZII-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |