C19H16FN3O3S — CID 9155700
N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]pyridine-2-carboxamide (PubChem CID 9155700) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]pyridine-2-carboxamide.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9155700 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)sulfonyl-2-pyridin-3-ylethyl]pyridine-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)S(=O)(=O)c1ccc(F)cc1)c1ccccn1 |
| InChI | InChI=1S/C19H16FN3O3S/c20-15-6-8-16(9-7-15)27(25,26)18(14-4-3-10-21-12-14)13-23-19(24)17-5-1-2-11-22-17/h1-12,18H,13H2,(H,23,24)/t18-/m0/s1 |
| InChIKey | JSYPCACBFJQELY-SFHVURJKSA-N |
| XLogP | 2.56 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |