C20H37N5O2 — CID 91557107
2,8-dimethyl-2,8-diazaspiro[4.5]decan-1-one;1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 91557107) has the molecular formula C20H37N5O2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2,8-dimethyl-2,8-diazaspiro[4.5]decan-1-one;1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 2,8-dimethyl-2,8-diazaspiro[4.5]decan-1-one;1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 91557107 |
| Molecular Formula | C20H37N5O2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.29 |
| IUPAC Name | 2,8-dimethyl-2,8-diazaspiro[4.5]decan-1-one;1,3,8-trimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CN1CCC2(CC1)CCN(C)C2=O.CN1CCC2(CC1)CN(C)C(=O)N2C |
| InChI | InChI=1S/C10H19N3O.C10H18N2O/c1-11-6-4-10(5-7-11)8-12(2)9(14)13(10)3;1-11-6-3-10(4-7-11)5-8-12(2)9(10)13/h4-8H2,1-3H3;3-8H2,1-2H3 |
| InChIKey | JDLDDRRLBAEBQD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |