C17H18N4O2S — CID 91557512
ethyl 3-(10-methyl-5H-pyrazino[2,3-b]quinoxalin-7-yl)-3-methylsulfanylprop-2-enoate (PubChem CID 91557512) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is ethyl 3-(10-methyl-5H-pyrazino[2,3-b]quinoxalin-7-yl)-3-methylsulfanylprop-2-enoate.
| Compound Name | ethyl 3-(10-methyl-5H-pyrazino[2,3-b]quinoxalin-7-yl)-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 91557512 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | ethyl 3-(10-methyl-5H-pyrazino[2,3-b]quinoxalin-7-yl)-3-methylsulfanylprop-2-enoate |
| SMILES | CCOC(=O)C=C(SC)c1ccc2c(c1)Nc1nccnc1N2C |
| InChI | InChI=1S/C17H18N4O2S/c1-4-23-15(22)10-14(24-3)11-5-6-13-12(9-11)20-16-17(21(13)2)19-8-7-18-16/h5-10H,4H2,1-3H3,(H,18,20) |
| InChIKey | OUBVTDULTVVMGU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|