C15H17BrO2S2 — CID 13399177
ethyl (2E)-3-(4-bromophenyl)-5,5-bis(methylsulfanyl)penta-2,4-dienoate (PubChem CID 13399177) has the molecular formula C15H17BrO2S2 and a molecular weight of 373.34 g/mol. Its IUPAC name is ethyl (2E)-3-(4-bromophenyl)-5,5-bis(methylsulfanyl)penta-2,4-dienoate.
| Compound Name | ethyl (2E)-3-(4-bromophenyl)-5,5-bis(methylsulfanyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 13399177 |
| Molecular Formula | C15H17BrO2S2 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | ethyl (2E)-3-(4-bromophenyl)-5,5-bis(methylsulfanyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C(SC)SC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H17BrO2S2/c1-4-18-14(17)9-12(10-15(19-2)20-3)11-5-7-13(16)8-6-11/h5-10H,4H2,1-3H3/b12-9+ |
| InChIKey | FZUKDOSDANIDJE-FMIVXFBMSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|