C14H13BrO4S2 — CID 170873620
2-[1-(4-bromophenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedioic acid (PubChem CID 170873620) has the molecular formula C14H13BrO4S2 and a molecular weight of 389.29 g/mol. Its IUPAC name is 2-[1-(4-bromophenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedioic acid.
| Compound Name | 2-[1-(4-bromophenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedioic acid |
|---|---|
| PubChem CID | 170873620 |
| Molecular Formula | C14H13BrO4S2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 387.94 |
| IUPAC Name | 2-[1-(4-bromophenyl)-3,3-bis(methylsulfanyl)prop-2-enylidene]propanedioic acid |
| SMILES | CSC(=CC(=C(C(=O)O)C(=O)O)c1ccc(Br)cc1)SC |
| InChI | InChI=1S/C14H13BrO4S2/c1-20-11(21-2)7-10(12(13(16)17)14(18)19)8-3-5-9(15)6-4-8/h3-7H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | FABZXOOPEKCSBQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|