C21H24FN5O2 — CID 91557836
N-[2-[(4-fluorophenyl)-(2-hydroxyethoxy)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N',3-dimethylbut-2-enimidamide (PubChem CID 91557836) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)-(2-hydroxyethoxy)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N',3-dimethylbut-2-enimidamide.
| Compound Name | N-[2-[(4-fluorophenyl)-(2-hydroxyethoxy)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N',3-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 91557836 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[2-[(4-fluorophenyl)-(2-hydroxyethoxy)methyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N',3-dimethylbut-2-enimidamide |
| SMILES | C/N=C(\C=C(C)C)Nc1nc(C(OCCO)c2ccc(F)cc2)nn2cccc12 |
| InChI | InChI=1S/C21H24FN5O2/c1-14(2)13-18(23-3)24-20-17-5-4-10-27(17)26-21(25-20)19(29-12-11-28)15-6-8-16(22)9-7-15/h4-10,13,19,28H,11-12H2,1-3H3,(H,23,24,25,26) |
| InChIKey | KYAGGPPPNQPGEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|