C19H18N4 — CID 91558483
(Z)-1-N-methyl-2-N-(1-phenylbenzimidazol-5-yl)pent-3-ene-1,2-diimine (PubChem CID 91558483) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is (Z)-1-N-methyl-2-N-(1-phenylbenzimidazol-5-yl)pent-3-ene-1,2-diimine.
| Compound Name | (Z)-1-N-methyl-2-N-(1-phenylbenzimidazol-5-yl)pent-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 91558483 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (Z)-1-N-methyl-2-N-(1-phenylbenzimidazol-5-yl)pent-3-ene-1,2-diimine |
| SMILES | C/C=C\C(\C=N\C)=N\c1ccc2c(c1)ncn2-c1ccccc1 |
| InChI | InChI=1S/C19H18N4/c1-3-7-16(13-20-2)22-15-10-11-19-18(12-15)21-14-23(19)17-8-5-4-6-9-17/h3-14H,1-2H3/b7-3-,20-13+,22-16- |
| InChIKey | DTDQBZYOEWRINN-WDSPJTPLSA-N |
| XLogP | 4.37 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|