C32H27F2O7S2+ — CID 91560774
[1,1-difluoro-2-[1-(5-hydroxynaphthalen-1-yl)oxyethoxy]-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium (PubChem CID 91560774) has the molecular formula C32H27F2O7S2+ and a molecular weight of 625.69 g/mol. Its IUPAC name is [1,1-difluoro-2-[1-(5-hydroxynaphthalen-1-yl)oxyethoxy]-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium.
| Compound Name | [1,1-difluoro-2-[1-(5-hydroxynaphthalen-1-yl)oxyethoxy]-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
|---|---|
| PubChem CID | 91560774 |
| Molecular Formula | C32H27F2O7S2+ |
| Molecular Weight | 625.69 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | [1,1-difluoro-2-[1-(5-hydroxynaphthalen-1-yl)oxyethoxy]-2-oxoethyl]sulfonyl-(triphenyl-λ4-sulfanyl)oxidanium |
| SMILES | CC(OC(=O)C(F)(F)S(=O)(=O)[OH+]S(c1ccccc1)(c1ccccc1)c1ccccc1)Oc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C32H26F2O7S2/c1-23(39-30-22-12-19-27-28(30)20-11-21-29(27)35)40-31(36)32(33,34)43(37,38)41-42(24-13-5-2-6-14-24,25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-23,35H,1H3/p+1 |
| InChIKey | SRPBXMRORIEXNJ-UHFFFAOYSA-O |
| XLogP | 7.73 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|