C32H26F2O7S2 — CID 91560775
1-(5-hydroxynaphthalen-1-yl)oxyethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 91560775) has the molecular formula C32H26F2O7S2 and a molecular weight of 624.68 g/mol. Its IUPAC name is 1-(5-hydroxynaphthalen-1-yl)oxyethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
| Compound Name | 1-(5-hydroxynaphthalen-1-yl)oxyethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
|---|---|
| PubChem CID | 91560775 |
| Molecular Formula | C32H26F2O7S2 |
| Molecular Weight | 624.68 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | 1-(5-hydroxynaphthalen-1-yl)oxyethyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | CC(OC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1)Oc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C32H26F2O7S2/c1-23(39-30-22-12-19-27-28(30)20-11-21-29(27)35)40-31(36)32(33,34)43(37,38)41-42(24-13-5-2-6-14-24,25-15-7-3-8-16-25)26-17-9-4-10-18-26/h2-23,35H,1H3 |
| InChIKey | SRPBXMRORIEXNJ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|