C20H9BrCl2N2O4S — CID 91563753
5-[(8-bromo-6-chloro-4-oxochromen-3-yl)methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91563753) has the molecular formula C20H9BrCl2N2O4S and a molecular weight of 524.18 g/mol. Its IUPAC name is 5-[(8-bromo-6-chloro-4-oxochromen-3-yl)methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(8-bromo-6-chloro-4-oxochromen-3-yl)methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91563753 |
| Molecular Formula | C20H9BrCl2N2O4S |
| Molecular Weight | 524.18 g/mol |
| Exact Mass | 521.88 |
| IUPAC Name | 5-[(8-bromo-6-chloro-4-oxochromen-3-yl)methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1coc2c(Br)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C20H9BrCl2N2O4S/c21-15-7-11(23)6-13-16(26)9(8-29-17(13)15)5-14-18(27)24-20(30)25(19(14)28)12-3-1-10(22)2-4-12/h1-8H,(H,24,27,30) |
| InChIKey | HNOSAPMXMSCGDC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|