C44H49B2N2OS2+ — CID 91564658
CID 91564658 (PubChem CID 91564658) has the molecular formula C44H49B2N2OS2+ and a molecular weight of 707.65 g/mol.
| Compound Name | CID 91564658 |
|---|---|
| PubChem CID | 91564658 |
| Molecular Formula | C44H49B2N2OS2+ |
| Molecular Weight | 707.65 g/mol |
| Exact Mass | 707.35 |
| IUPAC Name | — |
| SMILES | CC[n+]1c(C=CC=C2C=C(C=C3Sc4ccccc4N3C)CC(C)(C)C2)sc2ccccc21.C[B]c1ccc(OC)cc1.C[B]c1ccccc1 |
| InChI | InChI=1S/C29H31N2S2.C8H10BO.C7H8B/c1-5-31-24-13-7-9-15-26(24)32-27(31)16-10-11-21-17-22(20-29(2,3)19-21)18-28-30(4)23-12-6-8-14-25(23)33-28;1-9-7-3-5-8(10-2)6-4-7;1-8-7-5-3-2-4-6-7/h6-18H,5,19-20H2,1-4H3;3-6H,1-2H3;2-6H,1H3/q+1;; |
| InChIKey | CWYKLEOYDIYHDM-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.65 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|