C17H12F2N2O5 — CID 91565147
1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3,6-dicarboxylic acid (PubChem CID 91565147) has the molecular formula C17H12F2N2O5 and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3,6-dicarboxylic acid.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 91565147 |
| Molecular Formula | C17H12F2N2O5 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]indazole-3,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(C(=O)O)nn(Cc3ccc(OC(F)F)cc3)c2c1 |
| InChI | InChI=1S/C17H12F2N2O5/c18-17(19)26-11-4-1-9(2-5-11)8-21-13-7-10(15(22)23)3-6-12(13)14(20-21)16(24)25/h1-7,17H,8H2,(H,22,23)(H,24,25) |
| InChIKey | XASLYIORPWNOJJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |