C13H23N — CID 91565546
3,7-diethyl-2,4,6-trimethyl-5,6-dihydro-2H-azepine (PubChem CID 91565546) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 3,7-diethyl-2,4,6-trimethyl-5,6-dihydro-2H-azepine.
| Compound Name | 3,7-diethyl-2,4,6-trimethyl-5,6-dihydro-2H-azepine |
|---|---|
| PubChem CID | 91565546 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 3,7-diethyl-2,4,6-trimethyl-5,6-dihydro-2H-azepine |
| SMILES | CCC1=NC(C)C(CC)=C(C)CC1C |
| InChI | InChI=1S/C13H23N/c1-6-12-9(3)8-10(4)13(7-2)14-11(12)5/h10-11H,6-8H2,1-5H3 |
| InChIKey | SCVMAEMBIVNSKF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|