C11H19N — CID 118344871
3,5-diethyl-4-propan-2-yl-2H-pyrrole (PubChem CID 118344871) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,5-diethyl-4-propan-2-yl-2H-pyrrole.
| Compound Name | 3,5-diethyl-4-propan-2-yl-2H-pyrrole |
|---|---|
| PubChem CID | 118344871 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,5-diethyl-4-propan-2-yl-2H-pyrrole |
| SMILES | CCC1=NCC(CC)=C1C(C)C |
| InChI | InChI=1S/C11H19N/c1-5-9-7-12-10(6-2)11(9)8(3)4/h8H,5-7H2,1-4H3 |
| InChIKey | OQVMSCOFZHAYBP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |