C16H29N — CID 20647016
2,3,6-trimethyl-N,5-di(propan-2-yl)hepta-2,5-dien-4-imine (PubChem CID 20647016) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is 2,3,6-trimethyl-N,5-di(propan-2-yl)hepta-2,5-dien-4-imine.
| Compound Name | 2,3,6-trimethyl-N,5-di(propan-2-yl)hepta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 20647016 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | 2,3,6-trimethyl-N,5-di(propan-2-yl)hepta-2,5-dien-4-imine |
| SMILES | CC(C)=C(C)/C(=N\C(C)C)C(=C(C)C)C(C)C |
| InChI | InChI=1S/C16H29N/c1-10(2)14(9)16(17-13(7)8)15(11(3)4)12(5)6/h11,13H,1-9H3/b17-16+ |
| InChIKey | QFIYUXQJJYKWIO-WUKNDPDISA-N |
| XLogP | 5.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|