C12H23N — CID 59879255
(Z)-3,4,5-trimethyl-N-propan-2-ylhex-3-en-2-imine (PubChem CID 59879255) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z)-3,4,5-trimethyl-N-propan-2-ylhex-3-en-2-imine.
| Compound Name | (Z)-3,4,5-trimethyl-N-propan-2-ylhex-3-en-2-imine |
|---|---|
| PubChem CID | 59879255 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z)-3,4,5-trimethyl-N-propan-2-ylhex-3-en-2-imine |
| SMILES | CC(=C(\C)C(C)C)/C(C)=N/C(C)C |
| InChI | InChI=1S/C12H23N/c1-8(2)10(5)11(6)12(7)13-9(3)4/h8-9H,1-7H3/b11-10-,13-12+ |
| InChIKey | RUAPGORMBCLQPL-JPYSRSMKSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|