About N-ethyl-3,4-dimethylpent-3-en-2-imine
N-ethyl-3,4-dimethylpent-3-en-2-imine (PubChem CID 59576226) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is N-ethyl-3,4-dimethylpent-3-en-2-imine.
Molecular Properties
| Compound Name | N-ethyl-3,4-dimethylpent-3-en-2-imine |
| PubChem CID | 59576226 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N-ethyl-3,4-dimethylpent-3-en-2-imine |
| SMILES | CC/N=C(\C)C(C)=C(C)C |
| InChI | InChI=1S/C9H17N/c1-6-10-9(5)8(4)7(2)3/h6H2,1-5H3/b10-9+ |
| InChIKey | CBKLKRNBMWGLKU-MDZDMXLPSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3,4-dimethylpent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3,4-dimethylpent-3-en-2-imine?
The IUPAC name of N-ethyl-3,4-dimethylpent-3-en-2-imine (CID 59576226) is N-ethyl-3,4-dimethylpent-3-en-2-imine.
What is the SMILES notation for N-ethyl-3,4-dimethylpent-3-en-2-imine?
The canonical SMILES for N-ethyl-3,4-dimethylpent-3-en-2-imine is CC/N=C(\C)C(C)=C(C)C.
What is the InChIKey of N-ethyl-3,4-dimethylpent-3-en-2-imine?
The InChIKey is CBKLKRNBMWGLKU-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H17N/c1-6-10-9(5)8(4)7(2)3/h6H2,1-5H3/b10-9+.
What are the key properties of N-ethyl-3,4-dimethylpent-3-en-2-imine?
N-ethyl-3,4-dimethylpent-3-en-2-imine has a molecular weight of 139.24 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3,4-dimethylpent-3-en-2-imine is sourced from PubChem (CID 59576226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).