C10H11N3O5S — CID 91566919
5-[(4-methyl-3-nitrophenyl)methyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol (PubChem CID 91566919) has the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-[(4-methyl-3-nitrophenyl)methyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol.
| Compound Name | 5-[(4-methyl-3-nitrophenyl)methyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
|---|---|
| PubChem CID | 91566919 |
| Molecular Formula | C10H11N3O5S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-[(4-methyl-3-nitrophenyl)methyl]-1,1-dioxo-2H-1,2,5-thiadiazol-3-ol |
| SMILES | Cc1ccc(CN2C=C(O)NS2(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O5S/c1-7-2-3-8(4-9(7)13(15)16)5-12-6-10(14)11-19(12,17)18/h2-4,6,11,14H,5H2,1H3 |
| InChIKey | CMCGVHQLPITIMI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|