C19H14Cl3N3O2 — CID 91566989
N-(2-chloro-4-methyl-3-pyridinyl)-2-[(2,5-dichlorophenoxy)methyl]pyridine-3-carboxamide (PubChem CID 91566989) has the molecular formula C19H14Cl3N3O2 and a molecular weight of 422.70 g/mol. Its IUPAC name is N-(2-chloro-4-methyl-3-pyridinyl)-2-[(2,5-dichlorophenoxy)methyl]pyridine-3-carboxamide.
| Compound Name | N-(2-chloro-4-methyl-3-pyridinyl)-2-[(2,5-dichlorophenoxy)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91566989 |
| Molecular Formula | C19H14Cl3N3O2 |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-(2-chloro-4-methyl-3-pyridinyl)-2-[(2,5-dichlorophenoxy)methyl]pyridine-3-carboxamide |
| SMILES | Cc1ccnc(Cl)c1NC(=O)c1cccnc1COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H14Cl3N3O2/c1-11-6-8-24-18(22)17(11)25-19(26)13-3-2-7-23-15(13)10-27-16-9-12(20)4-5-14(16)21/h2-9H,10H2,1H3,(H,25,26) |
| InChIKey | VOGNEKZFQKXCOM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|