C21H13Cl2F3N2O4 — CID 140545560
[2-[(2,5-dichlorophenoxy)methyl]-6-(pyridin-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 140545560) has the molecular formula C21H13Cl2F3N2O4 and a molecular weight of 485.25 g/mol. Its IUPAC name is [2-[(2,5-dichlorophenoxy)methyl]-6-(pyridin-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[(2,5-dichlorophenoxy)methyl]-6-(pyridin-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140545560 |
| Molecular Formula | C21H13Cl2F3N2O4 |
| Molecular Weight | 485.25 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | [2-[(2,5-dichlorophenoxy)methyl]-6-(pyridin-2-ylcarbamoyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Nc1ccccn1)c1cccc(COc2cc(Cl)ccc2Cl)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H13Cl2F3N2O4/c22-13-7-8-15(23)16(10-13)31-11-12-4-3-5-14(18(12)32-20(30)21(24,25)26)19(29)28-17-6-1-2-9-27-17/h1-10H,11H2,(H,27,28,29) |
| InChIKey | WOOCHNLOTYSULI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.25 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|