C44H16F16N4 — CID 91567900
5,10,15,20-tetrakis(2,3,4,5-tetrafluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91567900) has the molecular formula C44H16F16N4 and a molecular weight of 904.61 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,3,4,5-tetrafluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(2,3,4,5-tetrafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91567900 |
| Molecular Formula | C44H16F16N4 |
| Molecular Weight | 904.61 g/mol |
| Exact Mass | 904.11 |
| IUPAC Name | 5,10,15,20-tetrakis(2,3,4,5-tetrafluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1cc(C2=c3ccc([nH]3)=C(c3cc(F)c(F)c(F)c3F)c3ccc([nH]3)C(c3cc(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3cc(F)c(F)c(F)c3F)c3ccc2[nH]3)c(F)c(F)c1F |
| InChI | InChI=1S/C44H16F16N4/c45-17-9-13(33(49)41(57)37(17)53)29-21-1-2-22(61-21)30(14-10-18(46)38(54)42(58)34(14)50)24-5-6-26(63-24)32(16-12-20(48)40(56)44(60)36(16)52)28-8-7-27(64-28)31(25-4-3-23(29)62-25)15-11-19(47)39(55)43(59)35(15)51/h1-12,61-64H |
| InChIKey | KXXKRGOPJKAXBY-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.61 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|