C34H25N3O3+2 — CID 91568262
6-[2-(2-methoxyphenyl)-1,3-benzoxazol-3-ium-3-yl]-12-phenyl-6H-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium (PubChem CID 91568262) has the molecular formula C34H25N3O3+2 and a molecular weight of 523.59 g/mol. Its IUPAC name is 6-[2-(2-methoxyphenyl)-1,3-benzoxazol-3-ium-3-yl]-12-phenyl-6H-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium.
| Compound Name | 6-[2-(2-methoxyphenyl)-1,3-benzoxazol-3-ium-3-yl]-12-phenyl-6H-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium |
|---|---|
| PubChem CID | 91568262 |
| Molecular Formula | C34H25N3O3+2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 6-[2-(2-methoxyphenyl)-1,3-benzoxazol-3-ium-3-yl]-12-phenyl-6H-benzimidazolo[1,2-c][1,3]benzoxazin-7-ium |
| SMILES | COc1ccccc1-c1oc2ccccc2[n+]1C1Oc2ccccc2-c2n(-c3ccccc3)c3ccccc3[n+]21 |
| InChI | InChI=1S/C34H25N3O3/c1-38-29-20-10-6-16-25(29)33-37(28-19-9-12-22-31(28)39-33)34-36-27-18-8-7-17-26(27)35(23-13-3-2-4-14-23)32(36)24-15-5-11-21-30(24)40-34/h2-22,34H,1H3/q+2 |
| InChIKey | PDHRDXKJRBTLGN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|