C15H12NO2Zn+ — CID 162483832
zinc 3-methanidyl-2-(2-methanidyloxyphenyl)-1,3-benzoxazol-3-ium (PubChem CID 162483832) has the molecular formula C15H12NO2Zn+ and a molecular weight of 303.66 g/mol. Its IUPAC name is zinc 3-methanidyl-2-(2-methanidyloxyphenyl)-1,3-benzoxazol-3-ium.
| Compound Name | zinc 3-methanidyl-2-(2-methanidyloxyphenyl)-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 162483832 |
| Molecular Formula | C15H12NO2Zn+ |
| Molecular Weight | 303.66 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | zinc 3-methanidyl-2-(2-methanidyloxyphenyl)-1,3-benzoxazol-3-ium |
| SMILES | [CH2-]Oc1ccccc1-c1oc2ccccc2[n+]1[CH2-].[Zn+2] |
| InChI | InChI=1S/C15H12NO2.Zn/c1-16-12-8-4-6-10-14(12)18-15(16)11-7-3-5-9-13(11)17-2;/h3-10H,1-2H2;/q-1;+2 |
| InChIKey | AKYSEAVPKHAHJW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|