C27H16N2O3+2 — CID 23561733
spiro[[1,3]benzoxazolo[3,2-c][1,3]benzoxazin-7-ium-6,11'-isoindolo[1,2-b][1,3]benzoxazol-10-ium] (PubChem CID 23561733) has the molecular formula C27H16N2O3+2 and a molecular weight of 416.44 g/mol. Its IUPAC name is spiro[[1,3]benzoxazolo[3,2-c][1,3]benzoxazin-7-ium-6,11'-isoindolo[1,2-b][1,3]benzoxazol-10-ium].
| Compound Name | spiro[[1,3]benzoxazolo[3,2-c][1,3]benzoxazin-7-ium-6,11'-isoindolo[1,2-b][1,3]benzoxazol-10-ium] |
|---|---|
| PubChem CID | 23561733 |
| Molecular Formula | C27H16N2O3+2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | spiro[[1,3]benzoxazolo[3,2-c][1,3]benzoxazin-7-ium-6,11'-isoindolo[1,2-b][1,3]benzoxazol-10-ium] |
| SMILES | c1ccc2c(c1)OC1(c3ccccc3-c3oc4ccccc4[n+]31)[n+]1c-2oc2ccccc21 |
| InChI | InChI=1S/C27H16N2O3/c1-3-11-19-17(9-1)25-28(20-12-4-7-15-23(20)30-25)27(19)29-21-13-5-8-16-24(21)31-26(29)18-10-2-6-14-22(18)32-27/h1-16H/q+2 |
| InChIKey | JWNYTEFWJMTLEX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 43.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|