C9H6FNO2S — CID 91570018
3-(4-fluorophenyl)-4-hydroxy-1,3-thiazol-2-one (PubChem CID 91570018) has the molecular formula C9H6FNO2S and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-hydroxy-1,3-thiazol-2-one.
| Compound Name | 3-(4-fluorophenyl)-4-hydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 91570018 |
| Molecular Formula | C9H6FNO2S |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 3-(4-fluorophenyl)-4-hydroxy-1,3-thiazol-2-one |
| SMILES | O=c1scc(O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C9H6FNO2S/c10-6-1-3-7(4-2-6)11-8(12)5-14-9(11)13/h1-5,12H |
| InChIKey | UIODOMQKLDXCBV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |