C17H10FNOS — CID 164670984
4-(4-fluorophenyl)thieno[3,2-b]quinolin-9-one (PubChem CID 164670984) has the molecular formula C17H10FNOS and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)thieno[3,2-b]quinolin-9-one.
| Compound Name | 4-(4-fluorophenyl)thieno[3,2-b]quinolin-9-one |
|---|---|
| PubChem CID | 164670984 |
| Molecular Formula | C17H10FNOS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-(4-fluorophenyl)thieno[3,2-b]quinolin-9-one |
| SMILES | O=c1c2ccccc2n(-c2ccc(F)cc2)c2ccsc12 |
| InChI | InChI=1S/C17H10FNOS/c18-11-5-7-12(8-6-11)19-14-4-2-1-3-13(14)16(20)17-15(19)9-10-21-17/h1-10H |
| InChIKey | XYKORZBSTODJDL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |